C37H37NO3 — CID 20580199
N-[4-[3,3-bis(3-methoxyphenyl)butyl]phenyl]-3-methoxy-N-phenylaniline (PubChem CID 20580199) has the molecular formula C37H37NO3 and a molecular weight of 543.71 g/mol. Its IUPAC name is N-[4-[3,3-bis(3-methoxyphenyl)butyl]phenyl]-3-methoxy-N-phenylaniline.
| Compound Name | N-[4-[3,3-bis(3-methoxyphenyl)butyl]phenyl]-3-methoxy-N-phenylaniline |
|---|---|
| PubChem CID | 20580199 |
| Molecular Formula | C37H37NO3 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | N-[4-[3,3-bis(3-methoxyphenyl)butyl]phenyl]-3-methoxy-N-phenylaniline |
| SMILES | COc1cccc(N(c2ccccc2)c2ccc(CCC(C)(c3cccc(OC)c3)c3cccc(OC)c3)cc2)c1 |
| InChI | InChI=1S/C37H37NO3/c1-37(29-11-8-16-34(25-29)39-2,30-12-9-17-35(26-30)40-3)24-23-28-19-21-32(22-20-28)38(31-13-6-5-7-14-31)33-15-10-18-36(27-33)41-4/h5-22,25-27H,23-24H2,1-4H3 |
| InChIKey | LJWNNSHVXYRQEG-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |