C21H21N3O2 — CID 20585514
4-[2,5-dimethyl-4-(5-nitro-2-pyridinyl)phenyl]-N,N-dimethylaniline (PubChem CID 20585514) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[2,5-dimethyl-4-(5-nitro-2-pyridinyl)phenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2,5-dimethyl-4-(5-nitro-2-pyridinyl)phenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 20585514 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[2,5-dimethyl-4-(5-nitro-2-pyridinyl)phenyl]-N,N-dimethylaniline |
| SMILES | Cc1cc(-c2ccc([N+](=O)[O-])cn2)c(C)cc1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-14-12-20(21-10-9-18(13-22-21)24(25)26)15(2)11-19(14)16-5-7-17(8-6-16)23(3)4/h5-13H,1-4H3 |
| InChIKey | QKCZZSWGJKCZBP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|