C8H6N4O4S2 — CID 20587221
4-hydroxy-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)disulfanyl]-1H-pyrimidin-6-one (PubChem CID 20587221) has the molecular formula C8H6N4O4S2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-hydroxy-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)disulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)disulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 20587221 |
| Molecular Formula | C8H6N4O4S2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 4-hydroxy-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)disulfanyl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(SSc2nc(O)cc(=O)[nH]2)[nH]1 |
| InChI | InChI=1S/C8H6N4O4S2/c13-3-1-4(14)10-7(9-3)17-18-8-11-5(15)2-6(16)12-8/h1-2H,(H2,9,10,13,14)(H2,11,12,15,16) |
| InChIKey | LFRXDUUUHJQXDP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|