C13H9N3O4S — CID 3959221
2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 3959221) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3959221 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nc(O)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H9N3O4S/c17-9-5-10(18)15-13(14-9)21-6-16-11(19)7-3-1-2-4-8(7)12(16)20/h1-5H,6H2,(H2,14,15,17,18) |
| InChIKey | AWAUKCVALAISCR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|