About methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate
methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 20588522) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
Analyze methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 20588522) is methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate is COC(=O)C1N=C(C)OC1C.
What is the InChIKey of methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is GAOPDRMSQFVYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-6(7(9)10-3)8-5(2)11-4/h4,6H,1-3H3.
What are the key properties of methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 157.17 g/mol, XLogP of 0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-dimethyl-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 20588522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).