C53H68O2 — CID 20588751
10,13-dimethyl-17-(6-methylheptan-2-yl)-3,3-bis[4-(4-methylphenoxy)phenyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 20588751) has the molecular formula C53H68O2 and a molecular weight of 737.12 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylheptan-2-yl)-3,3-bis[4-(4-methylphenoxy)phenyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-3,3-bis[4-(4-methylphenoxy)phenyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 20588751 |
| Molecular Formula | C53H68O2 |
| Molecular Weight | 737.12 g/mol |
| Exact Mass | 736.52 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-3,3-bis[4-(4-methylphenoxy)phenyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | Cc1ccc(Oc2ccc(C3(c4ccc(Oc5ccc(C)cc5)cc4)CCC4(C)C(CCC5C4CCC4(C)C(C(C)CCCC(C)C)CCC54)C3)cc2)cc1 |
| InChI | InChI=1S/C53H68O2/c1-36(2)9-8-10-39(5)48-29-30-49-47-28-19-42-35-53(34-33-51(42,6)50(47)31-32-52(48,49)7,40-15-24-45(25-16-40)54-43-20-11-37(3)12-21-43)41-17-26-46(27-18-41)55-44-22-13-38(4)14-23-44/h11-18,20-27,36,39,42,47-50H,8-10,19,28-35H2,1-7H3 |
| InChIKey | PZUPUCLOJAGSKM-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.12 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |