C42H62O3 — CID 88865779
3-(4-ethylperoxyphenyl)-3-(3-methoxyphenyl)-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 88865779) has the molecular formula C42H62O3 and a molecular weight of 614.96 g/mol. Its IUPAC name is 3-(4-ethylperoxyphenyl)-3-(3-methoxyphenyl)-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | 3-(4-ethylperoxyphenyl)-3-(3-methoxyphenyl)-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 88865779 |
| Molecular Formula | C42H62O3 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 614.47 |
| IUPAC Name | 3-(4-ethylperoxyphenyl)-3-(3-methoxyphenyl)-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CCOOc1ccc(C2(c3cccc(OC)c3)CCC3(C)C(CCC4C3CCC3(C)C(C(C)CCCC(C)C)CCC43)C2)cc1 |
| InChI | InChI=1S/C42H62O3/c1-8-44-45-34-18-15-31(16-19-34)42(32-13-10-14-35(27-32)43-7)26-25-40(5)33(28-42)17-20-36-38-22-21-37(30(4)12-9-11-29(2)3)41(38,6)24-23-39(36)40/h10,13-16,18-19,27,29-30,33,36-39H,8-9,11-12,17,20-26,28H2,1-7H3 |
| InChIKey | DGESRGZKLZSDMY-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|