C19H17NO3Si — CID 20591160
1-[[ethenyl(diphenyl)silyl]oxymethyl]pyrrole-2,5-dione (PubChem CID 20591160) has the molecular formula C19H17NO3Si and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-[[ethenyl(diphenyl)silyl]oxymethyl]pyrrole-2,5-dione.
| Compound Name | 1-[[ethenyl(diphenyl)silyl]oxymethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 20591160 |
| Molecular Formula | C19H17NO3Si |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[[ethenyl(diphenyl)silyl]oxymethyl]pyrrole-2,5-dione |
| SMILES | C=C[Si](OCN1C(=O)C=CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17NO3Si/c1-2-24(16-9-5-3-6-10-16,17-11-7-4-8-12-17)23-15-20-18(21)13-14-19(20)22/h2-14H,1,15H2 |
| InChIKey | DSAVBBDSJXSKHR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|