C23H26N2O2Si — CID 67080032
1-[3-(2,2-diphenylazasilinan-1-yl)propyl]pyrrole-2,5-dione (PubChem CID 67080032) has the molecular formula C23H26N2O2Si and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-[3-(2,2-diphenylazasilinan-1-yl)propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2,2-diphenylazasilinan-1-yl)propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67080032 |
| Molecular Formula | C23H26N2O2Si |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[3-(2,2-diphenylazasilinan-1-yl)propyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCN1CCCC[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2Si/c26-22-14-15-23(27)25(22)18-9-17-24-16-7-8-19-28(24,20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-6,10-15H,7-9,16-19H2 |
| InChIKey | BEQPXQFJAIGWCH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|