C23H26N5O4S+ — CID 20591483
N-[4-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,5-dimethylphenyl]-2-(4-methylpyridin-1-ium-1-yl)acetamide (PubChem CID 20591483) has the molecular formula C23H26N5O4S+ and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[4-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,5-dimethylphenyl]-2-(4-methylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[4-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,5-dimethylphenyl]-2-(4-methylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 20591483 |
| Molecular Formula | C23H26N5O4S+ |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[4-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,5-dimethylphenyl]-2-(4-methylpyridin-1-ium-1-yl)acetamide |
| SMILES | Cc1cc[n+](CC(=O)Nc2cc(C)c(S(=O)(=O)Nc3ccc(NNC=O)cc3)cc2C)cc1 |
| InChI | InChI=1S/C23H25N5O4S/c1-16-8-10-28(11-9-16)14-23(30)25-21-12-18(3)22(13-17(21)2)33(31,32)27-20-6-4-19(5-7-20)26-24-15-29/h4-13,15,26-27H,14H2,1-3H3,(H-,24,25,29,30)/p+1 |
| InChIKey | RQKRJWFFVAQRLY-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|