C27H40N4O5S2 — CID 59946777
N-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylphenyl]-2-(2-octoxyethylsulfanyl)acetamide (PubChem CID 59946777) has the molecular formula C27H40N4O5S2 and a molecular weight of 564.77 g/mol. Its IUPAC name is N-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylphenyl]-2-(2-octoxyethylsulfanyl)acetamide.
| Compound Name | N-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylphenyl]-2-(2-octoxyethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 59946777 |
| Molecular Formula | C27H40N4O5S2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | N-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylphenyl]-2-(2-octoxyethylsulfanyl)acetamide |
| SMILES | CCCCCCCCOCCSCC(=O)Nc1c(C)ccc(S(=O)(=O)Nc2ccc(NNC=O)cc2)c1C |
| InChI | InChI=1S/C27H40N4O5S2/c1-4-5-6-7-8-9-16-36-17-18-37-19-26(33)29-27-21(2)10-15-25(22(27)3)38(34,35)31-24-13-11-23(12-14-24)30-28-20-32/h10-15,20,30-31H,4-9,16-19H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | OZDFJWDFYXUZSU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|