C28H36ClN6O4S+ — CID 23524828
N-[4-[[5-[3-(4-butyl-3,5-dimethylpyridin-1-ium-1-yl)propylcarbamoylamino]-2-chlorophenyl]sulfonylamino]anilino]formamide (PubChem CID 23524828) has the molecular formula C28H36ClN6O4S+ and a molecular weight of 588.15 g/mol. Its IUPAC name is N-[4-[[5-[3-(4-butyl-3,5-dimethylpyridin-1-ium-1-yl)propylcarbamoylamino]-2-chlorophenyl]sulfonylamino]anilino]formamide.
| Compound Name | N-[4-[[5-[3-(4-butyl-3,5-dimethylpyridin-1-ium-1-yl)propylcarbamoylamino]-2-chlorophenyl]sulfonylamino]anilino]formamide |
|---|---|
| PubChem CID | 23524828 |
| Molecular Formula | C28H36ClN6O4S+ |
| Molecular Weight | 588.15 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | N-[4-[[5-[3-(4-butyl-3,5-dimethylpyridin-1-ium-1-yl)propylcarbamoylamino]-2-chlorophenyl]sulfonylamino]anilino]formamide |
| SMILES | CCCCc1c(C)c[n+](CCCNC(=O)Nc2ccc(Cl)c(S(=O)(=O)Nc3ccc(NNC=O)cc3)c2)cc1C |
| InChI | InChI=1S/C28H35ClN6O4S/c1-4-5-7-25-20(2)17-35(18-21(25)3)15-6-14-30-28(37)32-24-12-13-26(29)27(16-24)40(38,39)34-23-10-8-22(9-11-23)33-31-19-36/h8-13,16-19,33-34H,4-7,14-15H2,1-3H3,(H2-,30,31,32,36,37)/p+1 |
| InChIKey | LDZOUHCRTQBWTF-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.15 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|