C31H41N6O6S+ — CID 89354430
1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-(2-hydroxyethyl)-N-(4-methylpentan-2-yl)pyridin-1-ium-3-carboxamide (PubChem CID 89354430) has the molecular formula C31H41N6O6S+ and a molecular weight of 625.77 g/mol. Its IUPAC name is 1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-(2-hydroxyethyl)-N-(4-methylpentan-2-yl)pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-(2-hydroxyethyl)-N-(4-methylpentan-2-yl)pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 89354430 |
| Molecular Formula | C31H41N6O6S+ |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-(2-hydroxyethyl)-N-(4-methylpentan-2-yl)pyridin-1-ium-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NNC=O)cc2)c(C)c1NC(=O)C[n+]1cccc(C(=O)N(CCO)C(C)CC(C)C)c1 |
| InChI | InChI=1S/C31H40N6O6S/c1-21(2)17-23(4)37(15-16-38)31(41)25-7-6-14-36(18-25)19-29(40)33-30-22(3)8-13-28(24(30)5)44(42,43)35-27-11-9-26(10-12-27)34-32-20-39/h6-14,18,20-21,23,34-35,38H,15-17,19H2,1-5H3,(H-,32,33,39,40)/p+1 |
| InChIKey | RQIPOCLZLMWKJS-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|