C20H24FNO — CID 20591686
2-fluoro-3-(methoxymethyl)-6-[4-(4-methylcyclohexyl)phenyl]pyridine (PubChem CID 20591686) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-fluoro-3-(methoxymethyl)-6-[4-(4-methylcyclohexyl)phenyl]pyridine.
| Compound Name | 2-fluoro-3-(methoxymethyl)-6-[4-(4-methylcyclohexyl)phenyl]pyridine |
|---|---|
| PubChem CID | 20591686 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-fluoro-3-(methoxymethyl)-6-[4-(4-methylcyclohexyl)phenyl]pyridine |
| SMILES | COCc1ccc(-c2ccc(C3CCC(C)CC3)cc2)nc1F |
| InChI | InChI=1S/C20H24FNO/c1-14-3-5-15(6-4-14)16-7-9-17(10-8-16)19-12-11-18(13-23-2)20(21)22-19/h7-12,14-15H,3-6,13H2,1-2H3 |
| InChIKey | HAHAAAXTVWTWSF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|