C21H17F2N7O — CID 20595326
N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-1-(3-fluoronaphthalen-2-yl)tetrazole-5-carboxamide (PubChem CID 20595326) has the molecular formula C21H17F2N7O and a molecular weight of 421.41 g/mol. Its IUPAC name is N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-1-(3-fluoronaphthalen-2-yl)tetrazole-5-carboxamide.
| Compound Name | N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-1-(3-fluoronaphthalen-2-yl)tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 20595326 |
| Molecular Formula | C21H17F2N7O |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-1-(3-fluoronaphthalen-2-yl)tetrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2nnnn2-c2cc3ccccc3cc2F)c(F)c1)N(C)C |
| InChI | InChI=1S/C21H17F2N7O/c1-29(2)19(24)14-7-8-17(15(22)10-14)25-21(31)20-26-27-28-30(20)18-11-13-6-4-3-5-12(13)9-16(18)23/h3-11,24H,1-2H3,(H,25,31)/b24-19- |
| InChIKey | WQYBFCCVCXBMJW-CLCOLTQESA-N |
| XLogP | 3.23 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|