C21H17ClFN7O — CID 21366482
1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]tetrazole-5-carboxamide (PubChem CID 21366482) has the molecular formula C21H17ClFN7O and a molecular weight of 437.87 g/mol. Its IUPAC name is 1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]tetrazole-5-carboxamide.
| Compound Name | 1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 21366482 |
| Molecular Formula | C21H17ClFN7O |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]tetrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2nnnn2-c2ccc3cc(Cl)ccc3c2)c(F)c1)N(C)C |
| InChI | InChI=1S/C21H17ClFN7O/c1-29(2)19(24)14-5-8-18(17(23)11-14)25-21(31)20-26-27-28-30(20)16-7-4-12-9-15(22)6-3-13(12)10-16/h3-11,24H,1-2H3,(H,25,31)/b24-19- |
| InChIKey | SORXSNFJTDQXLI-CLCOLTQESA-N |
| XLogP | 3.75 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|