C24H21F2N7O — CID 21366447
1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide (PubChem CID 21366447) has the molecular formula C24H21F2N7O and a molecular weight of 461.48 g/mol. Its IUPAC name is 1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide.
| Compound Name | 1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 21366447 |
| Molecular Formula | C24H21F2N7O |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2nnnn2-c2cc3ccccc3cc2F)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H21F2N7O/c25-18-13-17(22(27)32-10-4-1-5-11-32)8-9-20(18)28-24(34)23-29-30-31-33(23)21-14-16-7-3-2-6-15(16)12-19(21)26/h2-3,6-9,12-14,27H,1,4-5,10-11H2,(H,28,34)/b27-22- |
| InChIKey | MTYNQJDXFWWIDO-QYQHSDTDSA-N |
| XLogP | 4.16 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|