C17H11F4N3O2 — CID 20597281
4-fluoro-3-hydroxy-N-[4-imidazol-1-yl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 20597281) has the molecular formula C17H11F4N3O2 and a molecular weight of 365.29 g/mol. Its IUPAC name is 4-fluoro-3-hydroxy-N-[4-imidazol-1-yl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-fluoro-3-hydroxy-N-[4-imidazol-1-yl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 20597281 |
| Molecular Formula | C17H11F4N3O2 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-fluoro-3-hydroxy-N-[4-imidazol-1-yl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2ccnc2)c(C(F)(F)F)c1)c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C17H11F4N3O2/c18-13-3-1-10(7-15(13)25)16(26)23-11-2-4-14(24-6-5-22-9-24)12(8-11)17(19,20)21/h1-9,25H,(H,23,26) |
| InChIKey | UKADCPICEMUVQV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |