C31H30O5 — CID 20597928
4-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-8-phenylmethoxynaphthalene-2-carboxylic acid (PubChem CID 20597928) has the molecular formula C31H30O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-8-phenylmethoxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-8-phenylmethoxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 20597928 |
| Molecular Formula | C31H30O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 4-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-8-phenylmethoxynaphthalene-2-carboxylic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2cc(C(=O)O)cc3c(OCc4ccccc4)cccc23)cc1 |
| InChI | InChI=1S/C31H30O5/c1-34-26-17-15-23(16-18-26)10-5-2-3-8-19-35-30-21-25(31(32)33)20-28-27(30)13-9-14-29(28)36-22-24-11-6-4-7-12-24/h4-7,9-18,20-21H,2-3,8,19,22H2,1H3,(H,32,33)/b10-5+ |
| InChIKey | HIDQNKTZMMINNP-BJMVGYQFSA-N |
| XLogP | 7.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|