C21H20FN5O3 — CID 20600245
[4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylbenzoate (PubChem CID 20600245) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylbenzoate.
| Compound Name | [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylbenzoate |
|---|---|
| PubChem CID | 20600245 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCOCNc2ccc(-c3nc4c(F)c(C)[nH]n4n3)cc2)cc1 |
| InChI | InChI=1S/C21H20FN5O3/c1-13-3-5-16(6-4-13)21(28)30-12-29-11-23-17-9-7-15(8-10-17)19-24-20-18(22)14(2)25-27(20)26-19/h3-10,23,25H,11-12H2,1-2H3 |
| InChIKey | MURKLHXXCOGDEK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|