C31H37Cl2N3O4 — CID 20601229
2-[5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid (PubChem CID 20601229) has the molecular formula C31H37Cl2N3O4 and a molecular weight of 586.56 g/mol. Its IUPAC name is 2-[5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid.
| Compound Name | 2-[5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 20601229 |
| Molecular Formula | C31H37Cl2N3O4 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-[5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid |
| SMILES | Cc1ccc(N2CC(CC(=O)O)(CC(=O)N3CCCC4CCCCC43)CN(Cc3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C31H37Cl2N3O4/c1-21-8-12-25(13-9-21)36-20-31(17-29(38)39,16-28(37)35-14-4-6-22-5-2-3-7-27(22)35)19-34(30(36)40)18-23-10-11-24(32)15-26(23)33/h8-13,15,22,27H,2-7,14,16-20H2,1H3,(H,38,39) |
| InChIKey | JBHRITAIJNTUOL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |