C25H30Cl2N2O — CID 142078816
1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one;prop-1-ene (PubChem CID 142078816) has the molecular formula C25H30Cl2N2O and a molecular weight of 445.43 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one;prop-1-ene.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one;prop-1-ene |
|---|---|
| PubChem CID | 142078816 |
| Molecular Formula | C25H30Cl2N2O |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one;prop-1-ene |
| SMILES | C=CC.C=CCC1(C)CN(Cc2ccc(Cl)cc2Cl)C(=O)N(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H24Cl2N2O.C3H6/c1-4-11-22(3)14-25(13-17-7-8-18(23)12-20(17)24)21(27)26(15-22)19-9-5-16(2)6-10-19;1-3-2/h4-10,12H,1,11,13-15H2,2-3H3;3H,1H2,2H3 |
| InChIKey | HDZUCHJLWXLZMW-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|