C30H39Cl2N3O4 — CID 20601176
2-[1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-5-[2-(octylamino)-2-oxoethyl]-2-oxo-1,3-diazinan-5-yl]acetic acid (PubChem CID 20601176) has the molecular formula C30H39Cl2N3O4 and a molecular weight of 576.57 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-5-[2-(octylamino)-2-oxoethyl]-2-oxo-1,3-diazinan-5-yl]acetic acid.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-5-[2-(octylamino)-2-oxoethyl]-2-oxo-1,3-diazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 20601176 |
| Molecular Formula | C30H39Cl2N3O4 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-5-[2-(octylamino)-2-oxoethyl]-2-oxo-1,3-diazinan-5-yl]acetic acid |
| SMILES | CCCCCCCCNC(=O)CC1(CC(=O)O)CN(Cc2ccc(Cl)cc2Cl)C(=O)N(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C30H39Cl2N3O4/c1-3-4-5-6-7-8-15-33-27(36)17-30(18-28(37)38)20-34(19-23-11-12-24(31)16-26(23)32)29(39)35(21-30)25-13-9-22(2)10-14-25/h9-14,16H,3-8,15,17-21H2,1-2H3,(H,33,36)(H,37,38) |
| InChIKey | HTPUMFJVFHVNCT-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|