C19H44N2O4Si4 — CID 20602894
3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane (PubChem CID 20602894) has the molecular formula C19H44N2O4Si4 and a molecular weight of 476.92 g/mol. Its IUPAC name is 3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane.
| Compound Name | 3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 20602894 |
| Molecular Formula | C19H44N2O4Si4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane |
| SMILES | COCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCCn1ccnc1)O[Si](C)(C)C |
| InChI | InChI=1S/C19H44N2O4Si4/c1-22-16-10-11-17-28(8,23-26(2,3)4)25-29(9,24-27(5,6)7)18-12-14-21-15-13-20-19-21/h13,15,19H,10-12,14,16-18H2,1-9H3 |
| InChIKey | WTXBLCPFLGIETE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|