C20H46N2O4Si4 — CID 23600219
4-imidazol-1-ylbutan-2-yl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane (PubChem CID 23600219) has the molecular formula C20H46N2O4Si4 and a molecular weight of 490.94 g/mol. Its IUPAC name is 4-imidazol-1-ylbutan-2-yl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane.
| Compound Name | 4-imidazol-1-ylbutan-2-yl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 23600219 |
| Molecular Formula | C20H46N2O4Si4 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 4-imidazol-1-ylbutan-2-yl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilyloxysilane |
| SMILES | COCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(O[Si](C)(C)C)C(C)CCn1ccnc1 |
| InChI | InChI=1S/C20H46N2O4Si4/c1-20(13-15-22-16-14-21-19-22)30(10,25-28(6,7)8)26-29(9,24-27(3,4)5)18-12-11-17-23-2/h14,16,19-20H,11-13,15,17-18H2,1-10H3 |
| InChIKey | JKVPNKPNRPTVEO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|