C22H54N2O6Si5 — CID 159351799
3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methylsilane;methane (PubChem CID 159351799) has the molecular formula C22H54N2O6Si5 and a molecular weight of 583.11 g/mol. Its IUPAC name is 3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methylsilane;methane.
| Compound Name | 3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methylsilane;methane |
|---|---|
| PubChem CID | 159351799 |
| Molecular Formula | C22H54N2O6Si5 |
| Molecular Weight | 583.11 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 3-imidazol-1-ylpropyl-(4-methoxybutyl-methyl-trimethylsilyloxysilyl)oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methylsilane;methane |
| SMILES | C.COCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCCn1ccnc1)O[Si](C)(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C21H50N2O6Si5.CH4/c1-24-18-12-13-19-32(9,26-30(3,4)5)28-33(10,20-14-16-23-17-15-22-21-23)29-34(11,25-2)27-31(6,7)8;/h15,17,21H,12-14,16,18-20H2,1-11H3;1H4 |
| InChIKey | LHKLDRAKGCTWAF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 73.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.11 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|