C37H28EuN2O2S — CID 20606813
4,7-diphenyl-1,10-phenanthroline;europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone (PubChem CID 20606813) has the molecular formula C37H28EuN2O2S and a molecular weight of 716.67 g/mol. Its IUPAC name is 4,7-diphenyl-1,10-phenanthroline;europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone.
| Compound Name | 4,7-diphenyl-1,10-phenanthroline;europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 20606813 |
| Molecular Formula | C37H28EuN2O2S |
| Molecular Weight | 716.67 g/mol |
| Exact Mass | 717.11 |
| IUPAC Name | 4,7-diphenyl-1,10-phenanthroline;europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone |
| SMILES | Cc1cc(C)c(O)c(C(=O)c2cccs2)c1.[Eu].c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C13H12O2S.Eu/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;1-8-6-9(2)12(14)10(7-8)13(15)11-4-3-5-16-11;/h1-16H;3-7,14H,1-2H3; |
| InChIKey | QHWKHZQIJZUPEM-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.67 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|