C27H29OPY+ — CID 20609722
2-methanidylprop-1-ene;2-methylprop-2-enoxymethylidene(triphenyl)-λ5-phosphane;yttrium(3+) (PubChem CID 20609722) has the molecular formula C27H29OPY+ and a molecular weight of 489.41 g/mol. Its IUPAC name is 2-methanidylprop-1-ene;2-methylprop-2-enoxymethylidene(triphenyl)-λ5-phosphane;yttrium(3+).
| Compound Name | 2-methanidylprop-1-ene;2-methylprop-2-enoxymethylidene(triphenyl)-λ5-phosphane;yttrium(3+) |
|---|---|
| PubChem CID | 20609722 |
| Molecular Formula | C27H29OPY+ |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-methanidylprop-1-ene;2-methylprop-2-enoxymethylidene(triphenyl)-λ5-phosphane;yttrium(3+) |
| SMILES | C=C([CH2-])C.[H]/[C-]=C(/C)COC=P(c1ccccc1)(c1ccccc1)c1ccccc1.[Y+3] |
| InChI | InChI=1S/C23H22OP.C4H7.Y/c1-20(2)18-24-19-25(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;1-4(2)3;/h1,3-17,19H,18H2,2H3;1-2H2,3H3;/q2*-1;+3 |
| InChIKey | SHHAETYXXKGDST-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|