C11H20ClNO2 — CID 20614522
3-chloro-N-(1-methoxypropan-2-yl)-1,3-dimethylcyclobutane-1-carboxamide (PubChem CID 20614522) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 3-chloro-N-(1-methoxypropan-2-yl)-1,3-dimethylcyclobutane-1-carboxamide.
| Compound Name | 3-chloro-N-(1-methoxypropan-2-yl)-1,3-dimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 20614522 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-chloro-N-(1-methoxypropan-2-yl)-1,3-dimethylcyclobutane-1-carboxamide |
| SMILES | COCC(C)NC(=O)C1(C)CC(C)(Cl)C1 |
| InChI | InChI=1S/C11H20ClNO2/c1-8(5-15-4)13-9(14)10(2)6-11(3,12)7-10/h8H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | WQEWEXSLROSDFZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|