C22H29F7O4 — CID 20615213
[4-[5-(4-ethylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 20615213) has the molecular formula C22H29F7O4 and a molecular weight of 490.46 g/mol. Its IUPAC name is [4-[5-(4-ethylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[5-(4-ethylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 20615213 |
| Molecular Formula | C22H29F7O4 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [4-[5-(4-ethylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCC1=CCC(C2COC(C3CCC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC3)OC2)CC1 |
| InChI | InChI=1S/C22H29F7O4/c1-2-13-3-5-14(6-4-13)16-11-31-18(32-12-16)15-7-9-17(10-8-15)33-19(30)20(23,24)21(25,26)22(27,28)29/h3,14-18H,2,4-12H2,1H3 |
| InChIKey | UJUDEBGVXDGKFH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|