C9H10AuKNO3S2 — CID 20615968
CID 20615968 (PubChem CID 20615968) has the molecular formula C9H10AuKNO3S2 and a molecular weight of 480.38 g/mol.
| Compound Name | CID 20615968 |
|---|---|
| PubChem CID | 20615968 |
| Molecular Formula | C9H10AuKNO3S2 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | — |
| SMILES | CC(=O)Nc1cc(C)cc(S(=O)(=O)[S-])c1.[Au+].[K] |
| InChI | InChI=1S/C9H11NO3S2.Au.K/c1-6-3-8(10-7(2)11)5-9(4-6)15(12,13)14;;/h3-5H,1-2H3,(H,10,11)(H,12,13,14);;/q;+1;/p-1 |
| InChIKey | AAQXWDMAORZKOQ-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|