C10H10AuKNO5S2 — CID 20627109
CID 20627109 (PubChem CID 20627109) has the molecular formula C10H10AuKNO5S2 and a molecular weight of 524.39 g/mol.
| Compound Name | CID 20627109 |
|---|---|
| PubChem CID | 20627109 |
| Molecular Formula | C10H10AuKNO5S2 |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 523.93 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cc(NC(C)=O)cc(S(=O)(=O)[S-])c1.[Au+].[K] |
| InChI | InChI=1S/C10H11NO5S2.Au.K/c1-6(12)11-8-3-7(10(13)16-2)4-9(5-8)18(14,15)17;;/h3-5H,1-2H3,(H,11,12)(H,14,15,17);;/q;+1;/p-1 |
| InChIKey | NHVJOHDRJITVAH-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|