C10H11NO5S2 — CID 20627110
methyl 3-acetamido-5-hydroxysulfonothioylbenzoate (PubChem CID 20627110) has the molecular formula C10H11NO5S2 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 3-acetamido-5-hydroxysulfonothioylbenzoate.
| Compound Name | methyl 3-acetamido-5-hydroxysulfonothioylbenzoate |
|---|---|
| PubChem CID | 20627110 |
| Molecular Formula | C10H11NO5S2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | methyl 3-acetamido-5-hydroxysulfonothioylbenzoate |
| SMILES | COC(=O)c1cc(NC(C)=O)cc(S(=O)(O)=S)c1 |
| InChI | InChI=1S/C10H11NO5S2/c1-6(12)11-8-3-7(10(13)16-2)4-9(5-8)18(14,15)17/h3-5H,1-2H3,(H,11,12)(H,14,15,17) |
| InChIKey | GRVAOSROQPEBAX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |