C55H35N3O4 — CID 20617925
(6Z)-6-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]cyclopenta[b]pyridine-5,7-dione (PubChem CID 20617925) has the molecular formula C55H35N3O4 and a molecular weight of 801.90 g/mol. Its IUPAC name is (6Z)-6-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]cyclopenta[b]pyridine-5,7-dione.
| Compound Name | (6Z)-6-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]cyclopenta[b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20617925 |
| Molecular Formula | C55H35N3O4 |
| Molecular Weight | 801.90 g/mol |
| Exact Mass | 801.26 |
| IUPAC Name | (6Z)-6-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]cyclopenta[b]pyridine-5,7-dione |
| SMILES | O=C1C(=Cc2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccccc5)c5ccc(/C=C6/C(=O)c7cccnc7C6=O)cc5)cc4)cc3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C55H35N3O4/c59-52-46-14-7-8-15-47(46)53(60)49(52)34-36-17-25-42(26-18-36)57(40-10-3-1-4-11-40)44-29-21-38(22-30-44)39-23-31-45(32-24-39)58(41-12-5-2-6-13-41)43-27-19-37(20-28-43)35-50-54(61)48-16-9-33-56-51(48)55(50)62/h1-35H/b50-35- |
| InChIKey | LMUXPRNGBLSXJC-PCIFVOTLSA-N |
| XLogP | 12.61 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.90 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|