C24H26N6O3S2 — CID 20618415
1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]carbamoylamino]phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 20618415) has the molecular formula C24H26N6O3S2 and a molecular weight of 510.65 g/mol. Its IUPAC name is 1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]carbamoylamino]phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]carbamoylamino]phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 20618415 |
| Molecular Formula | C24H26N6O3S2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]carbamoylamino]phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(Nc1cccc(N2C(C(=O)O)CC3CCCCC32)c1)Nc1cccc(-n2c(=S)[nH][nH]c2=S)c1 |
| InChI | InChI=1S/C24H26N6O3S2/c31-21(32)20-11-14-5-1-2-10-19(14)29(20)17-8-3-6-15(12-17)25-22(33)26-16-7-4-9-18(13-16)30-23(34)27-28-24(30)35/h3-4,6-9,12-14,19-20H,1-2,5,10-11H2,(H,27,34)(H,28,35)(H,31,32)(H2,25,26,33) |
| InChIKey | NACMQVQADHAOOI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|