C18H16N6O2S2 — CID 23576896
N-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-(3-oxopyrazolidin-1-yl)benzamide (PubChem CID 23576896) has the molecular formula C18H16N6O2S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-(3-oxopyrazolidin-1-yl)benzamide.
| Compound Name | N-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-(3-oxopyrazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 23576896 |
| Molecular Formula | C18H16N6O2S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-(3-oxopyrazolidin-1-yl)benzamide |
| SMILES | O=C1CCN(c2ccc(C(=O)Nc3cccc(-n4c(=S)[nH][nH]c4=S)c3)cc2)N1 |
| InChI | InChI=1S/C18H16N6O2S2/c25-15-8-9-23(22-15)13-6-4-11(5-7-13)16(26)19-12-2-1-3-14(10-12)24-17(27)20-21-18(24)28/h1-7,10H,8-9H2,(H,19,26)(H,20,27)(H,21,28)(H,22,25) |
| InChIKey | XTNJJGZXCZFBED-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|