C15H12N4O3S2 — CID 144612488
N-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-3,4-dihydroxybenzamide (PubChem CID 144612488) has the molecular formula C15H12N4O3S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 144612488 |
| Molecular Formula | C15H12N4O3S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | N-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-3,4-dihydroxybenzamide |
| SMILES | O=C(Nc1ccc(-n2c(=S)[nH][nH]c2=S)cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H12N4O3S2/c20-11-6-1-8(7-12(11)21)13(22)16-9-2-4-10(5-3-9)19-14(23)17-18-15(19)24/h1-7,20-21H,(H,16,22)(H,17,23)(H,18,24) |
| InChIKey | ASPIADRUIKQLFZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|