C25H28F3N3O8S — CID 20620407
N-hydroxy-4-[4-[3-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620407) has the molecular formula C25H28F3N3O8S and a molecular weight of 587.57 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620407 |
| Molecular Formula | C25H28F3N3O8S |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | N-hydroxy-4-[4-[3-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C1N(CCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)CCN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28F3N3O8S/c26-25(27,28)39-20-4-2-18(3-5-20)31-14-13-30(23(31)33)12-1-15-38-19-6-8-21(9-7-19)40(35,36)24(22(32)29-34)10-16-37-17-11-24/h2-9,34H,1,10-17H2,(H,29,32) |
| InChIKey | PHEMJOCDBAPAOH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|