C23H25NO6S — CID 20621363
2-benzyl-1-(1-hydroxy-2-methylpropyl)-4-methyl-4-phenylperoxysulfanyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 20621363) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is 2-benzyl-1-(1-hydroxy-2-methylpropyl)-4-methyl-4-phenylperoxysulfanyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | 2-benzyl-1-(1-hydroxy-2-methylpropyl)-4-methyl-4-phenylperoxysulfanyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 20621363 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-benzyl-1-(1-hydroxy-2-methylpropyl)-4-methyl-4-phenylperoxysulfanyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CC(C)C(O)C12C(=O)OC1C(C)(SOOc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H25NO6S/c1-15(2)18(25)23-19(28-21(23)27)22(3,31-30-29-17-12-8-5-9-13-17)20(26)24(23)14-16-10-6-4-7-11-16/h4-13,15,18-19,25H,14H2,1-3H3 |
| InChIKey | PFNLEINXUFBBFD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|