About oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate
oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 20622003) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate.
Analyze oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate?
The IUPAC name of oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate (CID 20622003) is oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate.
What is the SMILES notation for oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate?
The canonical SMILES for oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate is CCCC1CC(C)C2C3CC(C(=O)OC4CCCCO4)C(C3)C12.
What is the InChIKey of oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate?
The InChIKey is YQBBUONSWLGFMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3/c1-3-6-13-9-12(2)18-14-10-15(19(13)18)16(11-14)20(21)23-17-7-4-5-8-22-17/h12-19H,3-11H2,1-2H3.
What are the key properties of oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate?
oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate has a molecular weight of 320.47 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-yl 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8-carboxylate is sourced from PubChem (CID 20622003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).