C18H26N4O — CID 20622642
4-(8-butyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide (PubChem CID 20622642) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-(8-butyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide.
| Compound Name | 4-(8-butyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 20622642 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-(8-butyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC3(CCN(CCCC)CC3)C2)cc1 |
| InChI | InChI=1S/C18H26N4O/c1-2-3-10-22-11-8-18(9-12-22)13-16(21-23-18)14-4-6-15(7-5-14)17(19)20/h4-7H,2-3,8-13H2,1H3,(H3,19,20) |
| InChIKey | HVHYHZPQKZHKPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|