About methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate
methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate (PubChem CID 20624251) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate.
Analyze methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate?
The IUPAC name of methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate (CID 20624251) is methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate.
What is the SMILES notation for methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate?
The canonical SMILES for methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate is COC(=O)C(N)c1c(C)o[nH]c1=O.
What is the InChIKey of methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate?
The InChIKey is HTHUURYKWWGYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)5(8)7(11)12-2/h5H,8H2,1-2H3,(H,9,10).
What are the key properties of methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate?
methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate has a molecular weight of 186.17 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate is sourced from PubChem (CID 20624251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).