C42H77NO4 — CID 20624708
11-tert-butyl-14,16,20,22,28,34-hexamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione (PubChem CID 20624708) has the molecular formula C42H77NO4 and a molecular weight of 660.08 g/mol. Its IUPAC name is 11-tert-butyl-14,16,20,22,28,34-hexamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione.
| Compound Name | 11-tert-butyl-14,16,20,22,28,34-hexamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione |
|---|---|
| PubChem CID | 20624708 |
| Molecular Formula | C42H77NO4 |
| Molecular Weight | 660.08 g/mol |
| Exact Mass | 659.59 |
| IUPAC Name | 11-tert-butyl-14,16,20,22,28,34-hexamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione |
| SMILES | CC1CCCCCC(C)CC(C)CCCC(C)CC(C)CCC(C(C)(C)C)OC(=O)C2CCCN2C(=O)CC2OC(CC1)CCC2C |
| InChI | InChI=1S/C42H77NO4/c1-30-15-11-10-12-16-31(2)27-32(3)17-13-18-33(4)28-34(5)21-25-39(42(7,8)9)47-41(45)37-19-14-26-43(37)40(44)29-38-35(6)22-24-36(46-38)23-20-30/h30-39H,10-29H2,1-9H3 |
| InChIKey | NPDMJGLCFUAPCA-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.08 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |