C7H8S2 — CID 20632739
5-methyl-2,3-dihydrothieno[2,3-b]thiophene (PubChem CID 20632739) has the molecular formula C7H8S2 and a molecular weight of 156.28 g/mol. Its IUPAC name is 5-methyl-2,3-dihydrothieno[2,3-b]thiophene.
| Compound Name | 5-methyl-2,3-dihydrothieno[2,3-b]thiophene |
|---|---|
| PubChem CID | 20632739 |
| Molecular Formula | C7H8S2 |
| Molecular Weight | 156.28 g/mol |
| Exact Mass | 156.01 |
| IUPAC Name | 5-methyl-2,3-dihydrothieno[2,3-b]thiophene |
| SMILES | Cc1cc2c(s1)SCC2 |
| InChI | InChI=1S/C7H8S2/c1-5-4-6-2-3-8-7(6)9-5/h4H,2-3H2,1H3 |
| InChIKey | JILLVQALXMPNDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |