C25H33NO5 — CID 20633329
3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]-N-hexylpropanamide (PubChem CID 20633329) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]-N-hexylpropanamide.
| Compound Name | 3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]-N-hexylpropanamide |
|---|---|
| PubChem CID | 20633329 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CCc1ccc(CC2=C(C)C(=O)C(OC)=C(OC)C2=O)cc1 |
| InChI | InChI=1S/C25H33NO5/c1-5-6-7-8-15-26-21(27)14-13-18-9-11-19(12-10-18)16-20-17(2)22(28)24(30-3)25(31-4)23(20)29/h9-12H,5-8,13-16H2,1-4H3,(H,26,27) |
| InChIKey | RFWWTPWKJYTFEE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|