C11H24NO+ — CID 2063731
tert-butyl-(4,4-dimethyl-2-oxopentyl)azanium (PubChem CID 2063731) has the molecular formula C11H24NO+ and a molecular weight of 186.32 g/mol. Its IUPAC name is tert-butyl-(4,4-dimethyl-2-oxopentyl)azanium.
| Compound Name | tert-butyl-(4,4-dimethyl-2-oxopentyl)azanium |
|---|---|
| PubChem CID | 2063731 |
| Molecular Formula | C11H24NO+ |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.19 |
| IUPAC Name | tert-butyl-(4,4-dimethyl-2-oxopentyl)azanium |
| SMILES | CC(C)(C)CC(=O)C[NH2+]C(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-10(2,3)7-9(13)8-12-11(4,5)6/h12H,7-8H2,1-6H3/p+1 |
| InChIKey | AISCFAXFBTVNQG-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |