C19H17F6NO2S — CID 20638854
(4S)-5,5,5-trifluoro-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]-4-sulfanylpentanoic acid (PubChem CID 20638854) has the molecular formula C19H17F6NO2S and a molecular weight of 437.41 g/mol. Its IUPAC name is (4S)-5,5,5-trifluoro-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]-4-sulfanylpentanoic acid.
| Compound Name | (4S)-5,5,5-trifluoro-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]-4-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 20638854 |
| Molecular Formula | C19H17F6NO2S |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (4S)-5,5,5-trifluoro-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]-4-sulfanylpentanoic acid |
| SMILES | O=C(O)C(C[C@H](S)C(F)(F)F)NC(c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F6NO2S/c20-18(21,22)13-8-6-12(7-9-13)16(11-4-2-1-3-5-11)26-14(17(27)28)10-15(29)19(23,24)25/h1-9,14-16,26,29H,10H2,(H,27,28)/t14?,15-,16?/m0/s1 |
| InChIKey | QIIUIHLXRCBGOL-PCKAHOCUSA-N |
| XLogP | 5.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|