C25H34BrN3O5 — CID 20639709
5-bromo-3-[[(2S)-4-methyl-2-[[1-methyl-3-(2-methylpropyl)indole-2-carbonyl]amino]pentanoyl]amino]-4-oxopentanoic acid (PubChem CID 20639709) has the molecular formula C25H34BrN3O5 and a molecular weight of 536.47 g/mol. Its IUPAC name is 5-bromo-3-[[(2S)-4-methyl-2-[[1-methyl-3-(2-methylpropyl)indole-2-carbonyl]amino]pentanoyl]amino]-4-oxopentanoic acid.
| Compound Name | 5-bromo-3-[[(2S)-4-methyl-2-[[1-methyl-3-(2-methylpropyl)indole-2-carbonyl]amino]pentanoyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 20639709 |
| Molecular Formula | C25H34BrN3O5 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 5-bromo-3-[[(2S)-4-methyl-2-[[1-methyl-3-(2-methylpropyl)indole-2-carbonyl]amino]pentanoyl]amino]-4-oxopentanoic acid |
| SMILES | CC(C)Cc1c(C(=O)N[C@@H](CC(C)C)C(=O)NC(CC(=O)O)C(=O)CBr)n(C)c2ccccc12 |
| InChI | InChI=1S/C25H34BrN3O5/c1-14(2)10-17-16-8-6-7-9-20(16)29(5)23(17)25(34)28-19(11-15(3)4)24(33)27-18(12-22(31)32)21(30)13-26/h6-9,14-15,18-19H,10-13H2,1-5H3,(H,27,33)(H,28,34)(H,31,32)/t18?,19-/m0/s1 |
| InChIKey | UNZVUESJOXJFEN-GGYWPGCISA-N |
| XLogP | 3.44 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|