C29H30N4O — CID 20641007
N-[(E)-1-[5-[(E)-3,4-dihydro-2H-quinolin-1-yliminomethyl]-1-benzofuran-2-yl]ethylideneamino]-N-ethyl-4-methylaniline (PubChem CID 20641007) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[(E)-1-[5-[(E)-3,4-dihydro-2H-quinolin-1-yliminomethyl]-1-benzofuran-2-yl]ethylideneamino]-N-ethyl-4-methylaniline.
| Compound Name | N-[(E)-1-[5-[(E)-3,4-dihydro-2H-quinolin-1-yliminomethyl]-1-benzofuran-2-yl]ethylideneamino]-N-ethyl-4-methylaniline |
|---|---|
| PubChem CID | 20641007 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[(E)-1-[5-[(E)-3,4-dihydro-2H-quinolin-1-yliminomethyl]-1-benzofuran-2-yl]ethylideneamino]-N-ethyl-4-methylaniline |
| SMILES | CCN(/N=C(\C)c1cc2cc(/C=N/N3CCCc4ccccc43)ccc2o1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H30N4O/c1-4-32(26-14-11-21(2)12-15-26)31-22(3)29-19-25-18-23(13-16-28(25)34-29)20-30-33-17-7-9-24-8-5-6-10-27(24)33/h5-6,8,10-16,18-20H,4,7,9,17H2,1-3H3/b30-20+,31-22+ |
| InChIKey | VYTMIOWBCUYGGQ-XVLSOOQYSA-N |
| XLogP | 6.78 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|