C28H38N8O8 — CID 20641888
1-[2-[2-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]oxypropoxy]ethoxy]propan-2-yl 2-[[4-(diaminomethylideneamino)benzoyl]amino]acetate (PubChem CID 20641888) has the molecular formula C28H38N8O8 and a molecular weight of 614.66 g/mol. Its IUPAC name is 1-[2-[2-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]oxypropoxy]ethoxy]propan-2-yl 2-[[4-(diaminomethylideneamino)benzoyl]amino]acetate.
| Compound Name | 1-[2-[2-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]oxypropoxy]ethoxy]propan-2-yl 2-[[4-(diaminomethylideneamino)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 20641888 |
| Molecular Formula | C28H38N8O8 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | 1-[2-[2-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]oxypropoxy]ethoxy]propan-2-yl 2-[[4-(diaminomethylideneamino)benzoyl]amino]acetate |
| SMILES | CC(COCCOCC(C)OC(=O)CNC(=O)c1ccc(N=C(N)N)cc1)OC(=O)CNC(=O)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C28H38N8O8/c1-17(43-23(37)13-33-25(39)19-3-7-21(8-4-19)35-27(29)30)15-41-11-12-42-16-18(2)44-24(38)14-34-26(40)20-5-9-22(10-6-20)36-28(31)32/h3-10,17-18H,11-16H2,1-2H3,(H,33,39)(H,34,40)(H4,29,30,35)(H4,31,32,36) |
| InChIKey | TWQYTMDAKGDAMP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 258.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|